C9H13NO3 — CID 14069686
4-acetyl-5,5-dimethyl-3-methylidenemorpholin-2-one (PubChem CID 14069686) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-acetyl-5,5-dimethyl-3-methylidenemorpholin-2-one.
| Compound Name | 4-acetyl-5,5-dimethyl-3-methylidenemorpholin-2-one |
|---|---|
| PubChem CID | 14069686 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4-acetyl-5,5-dimethyl-3-methylidenemorpholin-2-one |
| SMILES | C=C1C(=O)OCC(C)(C)N1C(C)=O |
| InChI | InChI=1S/C9H13NO3/c1-6-8(12)13-5-9(3,4)10(6)7(2)11/h1,5H2,2-4H3 |
| InChIKey | BMCHNFBJDWWYAP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|