C13H19NO6S2 — CID 10915058
diethyl 2-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbothioyl)sulfanylpropanedioate (PubChem CID 10915058) has the molecular formula C13H19NO6S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is diethyl 2-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbothioyl)sulfanylpropanedioate.
| Compound Name | diethyl 2-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbothioyl)sulfanylpropanedioate |
|---|---|
| PubChem CID | 10915058 |
| Molecular Formula | C13H19NO6S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | diethyl 2-(4,4-dimethyl-2-oxo-1,3-oxazolidine-3-carbothioyl)sulfanylpropanedioate |
| SMILES | CCOC(=O)C(SC(=S)N1C(=O)OCC1(C)C)C(=O)OCC |
| InChI | InChI=1S/C13H19NO6S2/c1-5-18-9(15)8(10(16)19-6-2)22-12(21)14-11(17)20-7-13(14,3)4/h8H,5-7H2,1-4H3 |
| InChIKey | AUBBSLGDJXNKNO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|