C40H32ClN3O3 — CID 140697587
2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]propanoic acid (PubChem CID 140697587) has the molecular formula C40H32ClN3O3 and a molecular weight of 638.17 g/mol. Its IUPAC name is 2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]propanoic acid.
| Compound Name | 2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 140697587 |
| Molecular Formula | C40H32ClN3O3 |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | 2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]propanoic acid |
| SMILES | CC(/N=C(\c1ccccc1)c1cc(Cl)ccc1NC(=O)CN1Cc2ccc3ccccc3c2-c2c(ccc3ccccc23)C1)C(=O)O |
| InChI | InChI=1S/C40H32ClN3O3/c1-25(40(46)47)42-39(28-11-3-2-4-12-28)34-21-31(41)19-20-35(34)43-36(45)24-44-22-29-17-15-26-9-5-7-13-32(26)37(29)38-30(23-44)18-16-27-10-6-8-14-33(27)38/h2-21,25H,22-24H2,1H3,(H,43,45)(H,46,47)/b42-39+ |
| InChIKey | OCRSBJKVKRGSFW-VJSBBTEDSA-N |
| XLogP | 8.58 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|