C37H27N3O4 — CID 90252740
2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-N-(2-benzoyl-4-nitrophenyl)acetamide (PubChem CID 90252740) has the molecular formula C37H27N3O4 and a molecular weight of 577.64 g/mol. Its IUPAC name is 2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-N-(2-benzoyl-4-nitrophenyl)acetamide.
| Compound Name | 2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-N-(2-benzoyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 90252740 |
| Molecular Formula | C37H27N3O4 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)-N-(2-benzoyl-4-nitrophenyl)acetamide |
| SMILES | O=C(CN1Cc2ccc3ccccc3c2-c2c(ccc3ccccc23)C1)Nc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H27N3O4/c41-34(38-33-19-18-29(40(43)44)20-32(33)37(42)26-10-2-1-3-11-26)23-39-21-27-16-14-24-8-4-6-12-30(24)35(27)36-28(22-39)17-15-25-9-5-7-13-31(25)36/h1-20H,21-23H2,(H,38,41) |
| InChIKey | KNQSREQYTCKJCB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|