C42H34ClN3O5 — CID 76900602
(2R)-2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]pentanedioic acid (PubChem CID 76900602) has the molecular formula C42H34ClN3O5 and a molecular weight of 696.20 g/mol. Its IUPAC name is (2R)-2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]pentanedioic acid |
|---|---|
| PubChem CID | 76900602 |
| Molecular Formula | C42H34ClN3O5 |
| Molecular Weight | 696.20 g/mol |
| Exact Mass | 695.22 |
| IUPAC Name | (2R)-2-[[[2-[[2-(13-azapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-yl)acetyl]amino]-5-chlorophenyl]-phenylmethylidene]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](/N=C(\c1ccccc1)c1cc(Cl)ccc1NC(=O)CN1Cc2ccc3ccccc3c2-c2c(ccc3ccccc23)C1)C(=O)O |
| InChI | InChI=1S/C42H34ClN3O5/c43-31-18-19-35(34(22-31)41(28-10-2-1-3-11-28)45-36(42(50)51)20-21-38(48)49)44-37(47)25-46-23-29-16-14-26-8-4-6-12-32(26)39(29)40-30(24-46)17-15-27-9-5-7-13-33(27)40/h1-19,22,36H,20-21,23-25H2,(H,44,47)(H,48,49)(H,50,51)/b45-41+/t36-/m1/s1 |
| InChIKey | PEENINOVXHOMCH-WEXIHVLPSA-N |
| XLogP | 8.42 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.20 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|