C35H37N3O4 — CID 51032336
(2S,3S)-5-hydroxy-3-naphthalen-2-yl-2-[[phenyl-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]methylidene]amino]pentanoic acid (PubChem CID 51032336) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is (2S,3S)-5-hydroxy-3-naphthalen-2-yl-2-[[phenyl-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]methylidene]amino]pentanoic acid.
| Compound Name | (2S,3S)-5-hydroxy-3-naphthalen-2-yl-2-[[phenyl-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 51032336 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (2S,3S)-5-hydroxy-3-naphthalen-2-yl-2-[[phenyl-[2-[(2-piperidin-1-ylacetyl)amino]phenyl]methylidene]amino]pentanoic acid |
| SMILES | O=C(CN1CCCCC1)Nc1ccccc1/C(=N/[C@H](C(=O)O)[C@@H](CCO)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C35H37N3O4/c39-22-19-29(28-18-17-25-11-5-6-14-27(25)23-28)34(35(41)42)37-33(26-12-3-1-4-13-26)30-15-7-8-16-31(30)36-32(40)24-38-20-9-2-10-21-38/h1,3-8,11-18,23,29,34,39H,2,9-10,19-22,24H2,(H,36,40)(H,41,42)/b37-33+/t29-,34-/m0/s1 |
| InChIKey | HQWIWSYESLKEAK-JMARNWCMSA-N |
| XLogP | 5.72 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|