C32H35N3NiO5 — CID 51031717
(2R,3S)-5-hydroxy-3-(2-methoxyphenyl)-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) (PubChem CID 51031717) has the molecular formula C32H35N3NiO5 and a molecular weight of 600.34 g/mol. Its IUPAC name is (2R,3S)-5-hydroxy-3-(2-methoxyphenyl)-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+).
| Compound Name | (2R,3S)-5-hydroxy-3-(2-methoxyphenyl)-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) |
|---|---|
| PubChem CID | 51031717 |
| Molecular Formula | C32H35N3NiO5 |
| Molecular Weight | 600.34 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | (2R,3S)-5-hydroxy-3-(2-methoxyphenyl)-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) |
| SMILES | COc1ccccc1[C@H](CCO)[C@@H](/N=C(\c1ccccc1)c1ccccc1/N=C(\[O-])CN1CCCCC1)C(=O)[O-].[Ni+2] |
| InChI | InChI=1S/C32H37N3O5.Ni/c1-40-28-17-9-7-14-24(28)25(18-21-36)31(32(38)39)34-30(23-12-4-2-5-13-23)26-15-6-8-16-27(26)33-29(37)22-35-19-10-3-11-20-35;/h2,4-9,12-17,25,31,36H,3,10-11,18-22H2,1H3,(H,33,37)(H,38,39);/q;+2/p-2/b34-30+;/t25-,31+;/m0./s1 |
| InChIKey | SUJCSHCUWVBDKN-GDBCJARJSA-L |
| XLogP | 2.69 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|