C34H33N3NiO4 — CID 51031876
(2R,3S)-2-[[[2-[[2-[benzyl(methyl)amino]-1-oxidoethylidene]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoate;nickel(2+) (PubChem CID 51031876) has the molecular formula C34H33N3NiO4 and a molecular weight of 606.35 g/mol. Its IUPAC name is (2R,3S)-2-[[[2-[[2-[benzyl(methyl)amino]-1-oxidoethylidene]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoate;nickel(2+).
| Compound Name | (2R,3S)-2-[[[2-[[2-[benzyl(methyl)amino]-1-oxidoethylidene]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoate;nickel(2+) |
|---|---|
| PubChem CID | 51031876 |
| Molecular Formula | C34H33N3NiO4 |
| Molecular Weight | 606.35 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | (2R,3S)-2-[[[2-[[2-[benzyl(methyl)amino]-1-oxidoethylidene]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoate;nickel(2+) |
| SMILES | CN(C/C([O-])=N/c1ccccc1/C(=N/[C@@H](C(=O)[O-])[C@@H](CCO)c1ccccc1)c1ccccc1)Cc1ccccc1.[Ni+2] |
| InChI | InChI=1S/C34H35N3O4.Ni/c1-37(23-25-13-5-2-6-14-25)24-31(39)35-30-20-12-11-19-29(30)32(27-17-9-4-10-18-27)36-33(34(40)41)28(21-22-38)26-15-7-3-8-16-26;/h2-20,28,33,38H,21-24H2,1H3,(H,35,39)(H,40,41);/q;+2/p-2/b36-32+;/t28-,33+;/m0./s1 |
| InChIKey | PVWILUQQXIMYLB-APFMEQDWSA-L |
| XLogP | 3.33 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|