C20H22ClNO2 — CID 174332203
2-chloro-N-(2-ethenylphenyl)-5-hydroxy-N-methyl-3-phenylpentanamide (PubChem CID 174332203) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-chloro-N-(2-ethenylphenyl)-5-hydroxy-N-methyl-3-phenylpentanamide.
| Compound Name | 2-chloro-N-(2-ethenylphenyl)-5-hydroxy-N-methyl-3-phenylpentanamide |
|---|---|
| PubChem CID | 174332203 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-chloro-N-(2-ethenylphenyl)-5-hydroxy-N-methyl-3-phenylpentanamide |
| SMILES | C=Cc1ccccc1N(C)C(=O)C(Cl)C(CCO)c1ccccc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-3-15-9-7-8-12-18(15)22(2)20(24)19(21)17(13-14-23)16-10-5-4-6-11-16/h3-12,17,19,23H,1,13-14H2,2H3 |
| InChIKey | GOVHEOJAHALDDT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|