C34H35N3O4 — CID 51032472
(2S,3S)-2-[[[2-[[2-[benzyl(methyl)amino]acetyl]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoic acid (PubChem CID 51032472) has the molecular formula C34H35N3O4 and a molecular weight of 549.67 g/mol. Its IUPAC name is (2S,3S)-2-[[[2-[[2-[benzyl(methyl)amino]acetyl]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoic acid.
| Compound Name | (2S,3S)-2-[[[2-[[2-[benzyl(methyl)amino]acetyl]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 51032472 |
| Molecular Formula | C34H35N3O4 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | (2S,3S)-2-[[[2-[[2-[benzyl(methyl)amino]acetyl]amino]phenyl]-phenylmethylidene]amino]-5-hydroxy-3-phenylpentanoic acid |
| SMILES | CN(CC(=O)Nc1ccccc1/C(=N/[C@H](C(=O)O)[C@@H](CCO)c1ccccc1)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H35N3O4/c1-37(23-25-13-5-2-6-14-25)24-31(39)35-30-20-12-11-19-29(30)32(27-17-9-4-10-18-27)36-33(34(40)41)28(21-22-38)26-15-7-3-8-16-26/h2-20,28,33,38H,21-24H2,1H3,(H,35,39)(H,40,41)/b36-32+/t28-,33-/m0/s1 |
| InChIKey | BKTRATVFBJTYFD-IKKHCWMJSA-N |
| XLogP | 5.21 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|