C31H32ClN3NiO4 — CID 51031567
(2R,3S)-3-(2-chlorophenyl)-5-hydroxy-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) (PubChem CID 51031567) has the molecular formula C31H32ClN3NiO4 and a molecular weight of 604.76 g/mol. Its IUPAC name is (2R,3S)-3-(2-chlorophenyl)-5-hydroxy-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+).
| Compound Name | (2R,3S)-3-(2-chlorophenyl)-5-hydroxy-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) |
|---|---|
| PubChem CID | 51031567 |
| Molecular Formula | C31H32ClN3NiO4 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | (2R,3S)-3-(2-chlorophenyl)-5-hydroxy-2-[[[2-[(1-oxido-2-piperidin-1-ylethylidene)amino]phenyl]-phenylmethylidene]amino]pentanoate;nickel(2+) |
| SMILES | O=C([O-])[C@H](/N=C(\c1ccccc1)c1ccccc1/N=C(\[O-])CN1CCCCC1)[C@@H](CCO)c1ccccc1Cl.[Ni+2] |
| InChI | InChI=1S/C31H34ClN3O4.Ni/c32-26-15-7-5-13-23(26)24(17-20-36)30(31(38)39)34-29(22-11-3-1-4-12-22)25-14-6-8-16-27(25)33-28(37)21-35-18-9-2-10-19-35;/h1,3-8,11-16,24,30,36H,2,9-10,17-21H2,(H,33,37)(H,38,39);/q;+2/p-2/b34-29+;/t24-,30+;/m0./s1 |
| InChIKey | WJSZIWGAKZTKQS-JSACCIIZSA-L |
| XLogP | 3.34 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|