About 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide
2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide (PubChem CID 21153636) has the molecular formula C17H19BrN4O6
and a molecular weight of 455.27 g/mol. Its IUPAC name is 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide.
Molecular Properties
| Compound Name | 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide |
| PubChem CID | 21153636 |
| Molecular Formula | C17H19BrN4O6 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide |
| SMILES | Br.NC(=O)CNC(=O)CNc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1.O |
| InChI | InChI=1S/C17H16N4O5.BrH.H2O/c18-15(22)9-20-16(23)10-19-14-7-6-12(21(25)26)8-13(14)17(24)11-4-2-1-3-5-11;;/h1-8,19H,9-10H2,(H2,18,22)(H,20,23);1H;1H2 |
| InChIKey | STDAUIZTRMJXRQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 175.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide?
The IUPAC name of 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide (CID 21153636) is 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide.
What is the SMILES notation for 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide?
The canonical SMILES for 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide is Br.NC(=O)CNC(=O)CNc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1.O.
What is the InChIKey of 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide?
The InChIKey is STDAUIZTRMJXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O5.BrH.H2O/c18-15(22)9-20-16(23)10-19-14-7-6-12(21(25)26)8-13(14)17(24)11-4-2-1-3-5-11;;/h1-8,19H,9-10H2,(H2,18,22)(H,20,23);1H;1H2.
What are the key properties of 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide?
2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide has a molecular weight of 455.27 g/mol, XLogP of 0.59, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2-benzoyl-4-nitroanilino)acetyl]amino]acetamide;hydrate;hydrobromide is sourced from PubChem (CID 21153636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).