About pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate
pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate (PubChem CID 140699123) has the molecular formula C15H16NO3+
and a molecular weight of 258.30 g/mol. Its IUPAC name is pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate |
| PubChem CID | 140699123 |
| Molecular Formula | C15H16NO3+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate |
| SMILES | C[C@](O)(C(=O)OC[n+]1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16NO3/c1-15(18,13-8-4-2-5-9-13)14(17)19-12-16-10-6-3-7-11-16/h2-11,18H,12H2,1H3/q+1/t15-/m1/s1 |
| InChIKey | ZXBZMTHTQJWRNE-OAHLLOKOSA-N |
| XLogP | 1.38 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate?
The IUPAC name of pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate (CID 140699123) is pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate.
What is the SMILES notation for pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate?
The canonical SMILES for pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate is C[C@](O)(C(=O)OC[n+]1ccccc1)c1ccccc1.
What is the InChIKey of pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate?
The InChIKey is ZXBZMTHTQJWRNE-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H16NO3/c1-15(18,13-8-4-2-5-9-13)14(17)19-12-16-10-6-3-7-11-16/h2-11,18H,12H2,1H3/q+1/t15-/m1/s1.
What are the key properties of pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate?
pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate has a molecular weight of 258.30 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-ylmethyl (2R)-2-hydroxy-2-phenylpropanoate is sourced from PubChem (CID 140699123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).