C18H9F4O4S- — CID 140699169
2,3,5,6-tetrafluoro-4-(4-phenylphenoxy)benzenesulfonate (PubChem CID 140699169) has the molecular formula C18H9F4O4S- and a molecular weight of 397.33 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(4-phenylphenoxy)benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-(4-phenylphenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 140699169 |
| Molecular Formula | C18H9F4O4S- |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(4-phenylphenoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(Oc2ccc(-c3ccccc3)cc2)c(F)c1F |
| InChI | InChI=1S/C18H10F4O4S/c19-13-15(21)18(27(23,24)25)16(22)14(20)17(13)26-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,23,24,25)/p-1 |
| InChIKey | HLIJUDCGDNIDPV-UHFFFAOYSA-M |
| XLogP | 4.61 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|