C28H24Cl5N3O2 — CID 140710944
(2R)-2-amino-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-hydroxyiminopiperidin-1-yl]-3-phenylpropan-1-one;hydrochloride (PubChem CID 140710944) has the molecular formula C28H24Cl5N3O2 and a molecular weight of 611.78 g/mol. Its IUPAC name is (2R)-2-amino-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-hydroxyiminopiperidin-1-yl]-3-phenylpropan-1-one;hydrochloride.
| Compound Name | (2R)-2-amino-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-hydroxyiminopiperidin-1-yl]-3-phenylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 140710944 |
| Molecular Formula | C28H24Cl5N3O2 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 609.03 |
| IUPAC Name | (2R)-2-amino-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-hydroxyiminopiperidin-1-yl]-3-phenylpropan-1-one;hydrochloride |
| SMILES | Cl.N[C@H](Cc1ccccc1)C(=O)N1C/C(=C\c2ccc(Cl)c(Cl)c2)C(=NO)/C(=C/c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C28H23Cl4N3O2.ClH/c29-22-8-6-18(12-24(22)31)10-20-15-35(28(36)26(33)14-17-4-2-1-3-5-17)16-21(27(20)34-37)11-19-7-9-23(30)25(32)13-19;/h1-13,26,37H,14-16,33H2;1H/b20-10+,21-11+;/t26-;/m1./s1 |
| InChIKey | FHZNIDRXQFNDFN-VXZMDXPGSA-N |
| XLogP | 7.43 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|