C32H15N5O — CID 140711961
9-[3-(8-isocyanodibenzofuran-2-yl)phenyl]pyrido[2,3-b]indole-3,6-dicarbonitrile (PubChem CID 140711961) has the molecular formula C32H15N5O and a molecular weight of 485.51 g/mol. Its IUPAC name is 9-[3-(8-isocyanodibenzofuran-2-yl)phenyl]pyrido[2,3-b]indole-3,6-dicarbonitrile.
| Compound Name | 9-[3-(8-isocyanodibenzofuran-2-yl)phenyl]pyrido[2,3-b]indole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 140711961 |
| Molecular Formula | C32H15N5O |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 9-[3-(8-isocyanodibenzofuran-2-yl)phenyl]pyrido[2,3-b]indole-3,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc2oc3ccc(-c4cccc(-n5c6ccc(C#N)cc6c6cc(C#N)cnc65)c4)cc3c2c1 |
| InChI | InChI=1S/C32H15N5O/c1-35-23-7-10-31-27(15-23)26-14-22(6-9-30(26)38-31)21-3-2-4-24(13-21)37-29-8-5-19(16-33)11-25(29)28-12-20(17-34)18-36-32(28)37/h2-15,18H |
| InChIKey | CRZTXZNGNOKMIY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|