C38H43BN2O — CID 140712823
[3-[1-[4-(ethoxymethyl)-2,6-dimethylphenyl]imidazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140712823) has the molecular formula C38H43BN2O and a molecular weight of 554.59 g/mol. Its IUPAC name is [3-[1-[4-(ethoxymethyl)-2,6-dimethylphenyl]imidazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [3-[1-[4-(ethoxymethyl)-2,6-dimethylphenyl]imidazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140712823 |
| Molecular Formula | C38H43BN2O |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | [3-[1-[4-(ethoxymethyl)-2,6-dimethylphenyl]imidazol-2-yl]phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | CCOCc1cc(C)c(-n2ccnc2-c2cccc(B(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C38H43BN2O/c1-10-42-23-32-20-30(8)37(31(9)21-32)41-15-14-40-38(41)33-12-11-13-34(22-33)39(35-26(4)16-24(2)17-27(35)5)36-28(6)18-25(3)19-29(36)7/h11-22H,10,23H2,1-9H3 |
| InChIKey | PGBGJZRMOCLQDY-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|