C22H18NO8+ — CID 140714213
(3R,5R,6S)-6-(2-hepta-1,3,5-triynyl-1-hydroxyquinolin-1-ium-4-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 140714213) has the molecular formula C22H18NO8+ and a molecular weight of 424.39 g/mol. Its IUPAC name is (3R,5R,6S)-6-(2-hepta-1,3,5-triynyl-1-hydroxyquinolin-1-ium-4-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,5R,6S)-6-(2-hepta-1,3,5-triynyl-1-hydroxyquinolin-1-ium-4-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 140714213 |
| Molecular Formula | C22H18NO8+ |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (3R,5R,6S)-6-(2-hepta-1,3,5-triynyl-1-hydroxyquinolin-1-ium-4-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC#CC#CC#Cc1cc(O[C@@H]2OC(C(=O)O)[C@H](O)C(O)[C@H]2O)c2ccccc2[n+]1O |
| InChI | InChI=1S/C22H17NO8/c1-2-3-4-5-6-9-13-12-16(14-10-7-8-11-15(14)23(13)29)30-22-19(26)17(24)18(25)20(31-22)21(27)28/h7-8,10-12,17-20,22,24-26H,1H3,(H-,27,28,29)/p+1/t17?,18-,19-,20?,22-/m1/s1 |
| InChIKey | UQYLHKZFPYHMCX-SPFHDNFTSA-O |
| XLogP | -0.99 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|