C29H24NO11PS2 — CID 140717851
4-(8-phosphonooxy-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-3-sulfobenzenesulfonate (PubChem CID 140717851) has the molecular formula C29H24NO11PS2 and a molecular weight of 657.62 g/mol. Its IUPAC name is 4-(8-phosphonooxy-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-3-sulfobenzenesulfonate.
| Compound Name | 4-(8-phosphonooxy-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-3-sulfobenzenesulfonate |
|---|---|
| PubChem CID | 140717851 |
| Molecular Formula | C29H24NO11PS2 |
| Molecular Weight | 657.62 g/mol |
| Exact Mass | 657.05 |
| IUPAC Name | 4-(8-phosphonooxy-3-oxa-21-azoniahexacyclo[15.7.1.02,15.04,13.05,10.021,25]pentacosa-1,4(13),5(10),6,8,11,14,16,21(25)-nonaen-14-yl)-3-sulfobenzenesulfonate |
| SMILES | O=P(O)(O)Oc1ccc2c3c(ccc2c1)C(c1ccc(S(=O)(=O)[O-])cc1S(=O)(=O)O)=c1cc2c4c(c1O3)CCC[N+]=4CCC2 |
| InChI | InChI=1S/C29H24NO11PS2/c31-42(32,33)41-18-6-9-20-16(13-18)5-8-22-26(21-10-7-19(43(34,35)36)15-25(21)44(37,38)39)24-14-17-3-1-11-30-12-2-4-23(27(17)30)29(24)40-28(20)22/h5-10,13-15H,1-4,11-12H2,(H3-,31,32,33,34,35,36,37,38,39) |
| InChIKey | DSGYRIOMXTXTTA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 190.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|