C23H38N5O2S+ — CID 140718169
N'-butyl-N-[2-[2-(3-butylimidazol-3-ium-1-yl)ethyl-(4-methylphenyl)sulfonylamino]ethyl]methanimidamide (PubChem CID 140718169) has the molecular formula C23H38N5O2S+ and a molecular weight of 448.66 g/mol. Its IUPAC name is N'-butyl-N-[2-[2-(3-butylimidazol-3-ium-1-yl)ethyl-(4-methylphenyl)sulfonylamino]ethyl]methanimidamide.
| Compound Name | N'-butyl-N-[2-[2-(3-butylimidazol-3-ium-1-yl)ethyl-(4-methylphenyl)sulfonylamino]ethyl]methanimidamide |
|---|---|
| PubChem CID | 140718169 |
| Molecular Formula | C23H38N5O2S+ |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N'-butyl-N-[2-[2-(3-butylimidazol-3-ium-1-yl)ethyl-(4-methylphenyl)sulfonylamino]ethyl]methanimidamide |
| SMILES | CCCC/N=C/NCCN(CCn1cc[n+](CCCC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H38N5O2S/c1-4-6-12-24-20-25-13-15-28(31(29,30)23-10-8-22(3)9-11-23)19-18-27-17-16-26(21-27)14-7-5-2/h8-11,16-17,20-21H,4-7,12-15,18-19H2,1-3H3,(H,24,25)/q+1 |
| InChIKey | SNFKEFJKNZPIDK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|