C36H22N2O2Se — CID 140718587
3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]selenophen-2-yl]-(5-methylnaphthalen-1-yl)amino]benzonitrile (PubChem CID 140718587) has the molecular formula C36H22N2O2Se and a molecular weight of 593.54 g/mol. Its IUPAC name is 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]selenophen-2-yl]-(5-methylnaphthalen-1-yl)amino]benzonitrile.
| Compound Name | 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]selenophen-2-yl]-(5-methylnaphthalen-1-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 140718587 |
| Molecular Formula | C36H22N2O2Se |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]selenophen-2-yl]-(5-methylnaphthalen-1-yl)amino]benzonitrile |
| SMILES | Cc1cccc2c(N(c3cccc(C#N)c3)c3ccc(C=C4C(=O)c5cc6ccccc6cc5C4=O)[se]3)cccc12 |
| InChI | InChI=1S/C36H22N2O2Se/c1-22-7-4-13-29-28(22)12-6-14-33(29)38(26-11-5-8-23(17-26)21-37)34-16-15-27(41-34)20-32-35(39)30-18-24-9-2-3-10-25(24)19-31(30)36(32)40/h2-20H,1H3 |
| InChIKey | CZLHOAUYOSNOHJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|