C35H20N2O2S — CID 129181524
3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]thiophen-2-yl]-naphthalen-1-ylamino]benzonitrile (PubChem CID 129181524) has the molecular formula C35H20N2O2S and a molecular weight of 532.62 g/mol. Its IUPAC name is 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]thiophen-2-yl]-naphthalen-1-ylamino]benzonitrile.
| Compound Name | 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]thiophen-2-yl]-naphthalen-1-ylamino]benzonitrile |
|---|---|
| PubChem CID | 129181524 |
| Molecular Formula | C35H20N2O2S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 3-[[5-[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]thiophen-2-yl]-naphthalen-1-ylamino]benzonitrile |
| SMILES | N#Cc1cccc(N(c2ccc(C=C3C(=O)c4cc5ccccc5cc4C3=O)s2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C35H20N2O2S/c36-21-22-7-5-12-26(17-22)37(32-14-6-11-23-8-3-4-13-28(23)32)33-16-15-27(40-33)20-31-34(38)29-18-24-9-1-2-10-25(24)19-30(29)35(31)39/h1-20H |
| InChIKey | XRYQYROOHVVMOY-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|