C30H17F4NOS — CID 146551923
(2Z)-4,5,6,7-tetrafluoro-2-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-3H-inden-1-one (PubChem CID 146551923) has the molecular formula C30H17F4NOS and a molecular weight of 515.53 g/mol. Its IUPAC name is (2Z)-4,5,6,7-tetrafluoro-2-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-3H-inden-1-one.
| Compound Name | (2Z)-4,5,6,7-tetrafluoro-2-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 146551923 |
| Molecular Formula | C30H17F4NOS |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | (2Z)-4,5,6,7-tetrafluoro-2-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-3H-inden-1-one |
| SMILES | O=C1/C(=C\c2ccc(N(c3ccccc3)c3cccc4ccccc34)s2)Cc2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C30H17F4NOS/c31-26-22-16-18(30(36)25(22)27(32)29(34)28(26)33)15-20-13-14-24(37-20)35(19-9-2-1-3-10-19)23-12-6-8-17-7-4-5-11-21(17)23/h1-15H,16H2/b18-15- |
| InChIKey | ZYDVJSCTVZZDPU-SDXDJHTJSA-N |
| XLogP | 8.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|