C34H19Cl2NO2S — CID 129181637
2-[[5-(3-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 129181637) has the molecular formula C34H19Cl2NO2S and a molecular weight of 576.50 g/mol. Its IUPAC name is 2-[[5-(3-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-(3-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 129181637 |
| Molecular Formula | C34H19Cl2NO2S |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 2-[[5-(3-chloro-N-(4-chloronaphthalen-1-yl)anilino)thiophen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3cccc(Cl)c3)c3ccc(Cl)c4ccccc34)s2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C34H19Cl2NO2S/c35-22-8-5-9-23(18-22)37(31-14-13-30(36)25-10-3-4-11-26(25)31)32-15-12-24(40-32)19-29-33(38)27-16-20-6-1-2-7-21(20)17-28(27)34(29)39/h1-19H |
| InChIKey | LAUXCSXEOJNSAS-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|