C29H21N3O2S — CID 121364175
(5E)-1,4-dimethyl-5-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 121364175) has the molecular formula C29H21N3O2S and a molecular weight of 475.57 g/mol. Its IUPAC name is (5E)-1,4-dimethyl-5-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1,4-dimethyl-5-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 121364175 |
| Molecular Formula | C29H21N3O2S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (5E)-1,4-dimethyl-5-[[5-(N-naphthalen-1-ylanilino)thiophen-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C/c1ccc(N(c2ccccc2)c2cccc3ccccc23)s1 |
| InChI | InChI=1S/C29H21N3O2S/c1-19-24(28(33)31(2)29(34)25(19)18-30)17-22-15-16-27(35-22)32(21-11-4-3-5-12-21)26-14-8-10-20-9-6-7-13-23(20)26/h3-17H,1-2H3/b24-17+ |
| InChIKey | GWOBTEGHLBJGGI-JJIBRWJFSA-N |
| XLogP | 6.59 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|