C45H50Cl2N2OSiZr — CID 140721274
bis(5,8-dimethylindeno[1,2-b]indol-10-id-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane;dichlorozirconium(2+) (PubChem CID 140721274) has the molecular formula C45H50Cl2N2OSiZr and a molecular weight of 825.12 g/mol. Its IUPAC name is bis(5,8-dimethylindeno[1,2-b]indol-10-id-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane;dichlorozirconium(2+).
| Compound Name | bis(5,8-dimethylindeno[1,2-b]indol-10-id-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane;dichlorozirconium(2+) |
|---|---|
| PubChem CID | 140721274 |
| Molecular Formula | C45H50Cl2N2OSiZr |
| Molecular Weight | 825.12 g/mol |
| Exact Mass | 822.21 |
| IUPAC Name | bis(5,8-dimethylindeno[1,2-b]indol-10-id-10-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane;dichlorozirconium(2+) |
| SMILES | Cc1ccc2c(c1)c1c(c3ccccc3[c-]1[Si](C)(CCCCCCOC(C)(C)C)[c-]1c3ccccc3c3c1c1cc(C)ccc1n3C)n2C.Cl[Zr+2]Cl |
| InChI | InChI=1S/C45H50N2OSi.2ClH.Zr/c1-29-21-23-37-35(27-29)39-41(46(37)6)31-17-11-13-19-33(31)43(39)49(8,26-16-10-9-15-25-48-45(3,4)5)44-34-20-14-12-18-32(34)42-40(44)36-28-30(2)22-24-38(36)47(42)7;;;/h11-14,17-24,27-28H,9-10,15-16,25-26H2,1-8H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | AFCDRSHZANCEKE-UHFFFAOYSA-L |
| XLogP | 12.28 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.12 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|