C28H29F3N7O2+ — CID 140722617
3-[[5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carbonyl]amino]propyl-trimethylazanium (PubChem CID 140722617) has the molecular formula C28H29F3N7O2+ and a molecular weight of 552.58 g/mol. Its IUPAC name is 3-[[5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carbonyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carbonyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 140722617 |
| Molecular Formula | C28H29F3N7O2+ |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 3-[[5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carbonyl]amino]propyl-trimethylazanium |
| SMILES | [C-]#[N+]c1ccc(-n2nccc2-c2c(C)n(-c3cccc(C(F)(F)F)c3)c(=O)n2C(=O)NCCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C28H28F3N7O2/c1-19-25(24-14-16-34-37(24)22-12-10-21(32-2)11-13-22)36(26(39)33-15-7-17-38(3,4)5)27(40)35(19)23-9-6-8-20(18-23)28(29,30)31/h6,8-14,16,18H,7,15,17H2,1,3-5H3/p+1 |
| InChIKey | ZAOUHQSXBFQLBO-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|