C35H34F3N7O5S — CID 159376712
benzenesulfonate;N-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide (PubChem CID 159376712) has the molecular formula C35H34F3N7O5S and a molecular weight of 721.76 g/mol. Its IUPAC name is benzenesulfonate;N-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide.
| Compound Name | benzenesulfonate;N-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 159376712 |
| Molecular Formula | C35H34F3N7O5S |
| Molecular Weight | 721.76 g/mol |
| Exact Mass | 721.23 |
| IUPAC Name | benzenesulfonate;N-(1,1-dimethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
| SMILES | O=S(=O)([O-])c1ccccc1.[C-]#[N+]c1ccc(-n2nccc2-c2c(C)n(-c3cccc(C(F)(F)F)c3)c(=O)n2C(=O)NC2CC[N+](C)(C)CC2)cc1 |
| InChI | InChI=1S/C29H28F3N7O2.C6H6O3S/c1-19-26(25-12-15-34-38(25)23-10-8-21(33-2)9-11-23)37(27(40)35-22-13-16-39(3,4)17-14-22)28(41)36(19)24-7-5-6-20(18-24)29(30,31)32;7-10(8,9)6-4-2-1-3-5-6/h5-12,15,18,22H,13-14,16-17H2,1,3-4H3;1-5H,(H,7,8,9) |
| InChIKey | LKKHIUPHTLWMLC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.76 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|