C31H33F3N7O2+ — CID 140816032
N-(1,1-diethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide (PubChem CID 140816032) has the molecular formula C31H33F3N7O2+ and a molecular weight of 592.65 g/mol. Its IUPAC name is N-(1,1-diethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide.
| Compound Name | N-(1,1-diethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 140816032 |
| Molecular Formula | C31H33F3N7O2+ |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | N-(1,1-diethylpiperidin-1-ium-4-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-n2nccc2-c2c(C)n(-c3cccc(C(F)(F)F)c3)c(=O)n2C(=O)NC2CC[N+](CC)(CC)CC2)cc1 |
| InChI | InChI=1S/C31H32F3N7O2/c1-5-41(6-2)18-15-24(16-19-41)37-29(42)39-28(27-14-17-36-40(27)25-12-10-23(35-4)11-13-25)21(3)38(30(39)43)26-9-7-8-22(20-26)31(32,33)34/h7-14,17,20,24H,5-6,15-16,18-19H2,1-3H3/p+1 |
| InChIKey | JOMBYJBMBXOGPY-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|