C32H33F3N7O2+ — CID 140816036
N-(7,7-dimethyl-7-azoniaspiro[3.5]nonan-2-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide (PubChem CID 140816036) has the molecular formula C32H33F3N7O2+ and a molecular weight of 604.66 g/mol. Its IUPAC name is N-(7,7-dimethyl-7-azoniaspiro[3.5]nonan-2-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide.
| Compound Name | N-(7,7-dimethyl-7-azoniaspiro[3.5]nonan-2-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 140816036 |
| Molecular Formula | C32H33F3N7O2+ |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | N-(7,7-dimethyl-7-azoniaspiro[3.5]nonan-2-yl)-5-[2-(4-isocyanophenyl)pyrazol-3-yl]-4-methyl-2-oxo-3-[3-(trifluoromethyl)phenyl]imidazole-1-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-n2nccc2-c2c(C)n(-c3cccc(C(F)(F)F)c3)c(=O)n2C(=O)NC2CC3(CC[N+](C)(C)CC3)C2)cc1 |
| InChI | InChI=1S/C32H32F3N7O2/c1-21-28(27-12-15-37-41(27)25-10-8-23(36-2)9-11-25)40(30(44)39(21)26-7-5-6-22(18-26)32(33,34)35)29(43)38-24-19-31(20-24)13-16-42(3,4)17-14-31/h5-12,15,18,24H,13-14,16-17,19-20H2,1,3-4H3/p+1 |
| InChIKey | NEYVLOOGBDBPKR-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 78.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|