About 1-methylfuro[2,3-d]triazole;platinum
1-methylfuro[2,3-d]triazole;platinum (PubChem CID 140729639) has the molecular formula C5H5N3OPt
and a molecular weight of 318.19 g/mol. Its IUPAC name is 1-methylfuro[2,3-d]triazole;platinum.
Molecular Properties
| Compound Name | 1-methylfuro[2,3-d]triazole;platinum |
| PubChem CID | 140729639 |
| Molecular Formula | C5H5N3OPt |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 1-methylfuro[2,3-d]triazole;platinum |
| SMILES | Cn1nnc2occc21.[Pt] |
| InChI | InChI=1S/C5H5N3O.Pt/c1-8-4-2-3-9-5(4)6-7-8;/h2-3H,1H3; |
| InChIKey | NRBYJCWDYBGLKU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylfuro[2,3-d]triazole;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylfuro[2,3-d]triazole;platinum?
The IUPAC name of 1-methylfuro[2,3-d]triazole;platinum (CID 140729639) is 1-methylfuro[2,3-d]triazole;platinum.
What is the SMILES notation for 1-methylfuro[2,3-d]triazole;platinum?
The canonical SMILES for 1-methylfuro[2,3-d]triazole;platinum is Cn1nnc2occc21.[Pt].
What is the InChIKey of 1-methylfuro[2,3-d]triazole;platinum?
The InChIKey is NRBYJCWDYBGLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.Pt/c1-8-4-2-3-9-5(4)6-7-8;/h2-3H,1H3;.
What are the key properties of 1-methylfuro[2,3-d]triazole;platinum?
1-methylfuro[2,3-d]triazole;platinum has a molecular weight of 318.19 g/mol, XLogP of 0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylfuro[2,3-d]triazole;platinum is sourced from PubChem (CID 140729639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).