C6H5N3O — CID 162890435
3-methylfuro[2,3-e][1,2,4]triazine (PubChem CID 162890435) has the molecular formula C6H5N3O and a molecular weight of 135.13 g/mol. Its IUPAC name is 3-methylfuro[2,3-e][1,2,4]triazine.
| Compound Name | 3-methylfuro[2,3-e][1,2,4]triazine |
|---|---|
| PubChem CID | 162890435 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 3-methylfuro[2,3-e][1,2,4]triazine |
| SMILES | Cc1nnc2ccoc2n1 |
| InChI | InChI=1S/C6H5N3O/c1-4-7-6-5(9-8-4)2-3-10-6/h2-3H,1H3 |
| InChIKey | UAHIWNJSSLGEMQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |