C6H5NOS — CID 140729886
2-methylfuro[3,2-d][1,3]thiazole (PubChem CID 140729886) has the molecular formula C6H5NOS and a molecular weight of 139.18 g/mol. Its IUPAC name is 2-methylfuro[3,2-d][1,3]thiazole.
| Compound Name | 2-methylfuro[3,2-d][1,3]thiazole |
|---|---|
| PubChem CID | 140729886 |
| Molecular Formula | C6H5NOS |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.01 |
| IUPAC Name | 2-methylfuro[3,2-d][1,3]thiazole |
| SMILES | Cc1nc2ccoc2s1 |
| InChI | InChI=1S/C6H5NOS/c1-4-7-5-2-3-8-6(5)9-4/h2-3H,1H3 |
| InChIKey | VFIFQSQICAUZRM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |