C27H30N8O2S — CID 140733094
N-[3-[[5-isocyano-6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]pyrrolo[2,3-b]pyridin-1-yl]methyl]-2-pyridinyl]-N-methylmethanesulfonamide (PubChem CID 140733094) has the molecular formula C27H30N8O2S and a molecular weight of 530.66 g/mol. Its IUPAC name is N-[3-[[5-isocyano-6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]pyrrolo[2,3-b]pyridin-1-yl]methyl]-2-pyridinyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-[[5-isocyano-6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]pyrrolo[2,3-b]pyridin-1-yl]methyl]-2-pyridinyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 140733094 |
| Molecular Formula | C27H30N8O2S |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[3-[[5-isocyano-6-[4-[(3S)-3-methylpiperazin-1-yl]anilino]pyrrolo[2,3-b]pyridin-1-yl]methyl]-2-pyridinyl]-N-methylmethanesulfonamide |
| SMILES | [C-]#[N+]c1cc2ccn(Cc3cccnc3N(C)S(C)(=O)=O)c2nc1Nc1ccc(N2CCN[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C27H30N8O2S/c1-19-17-34(15-13-29-19)23-9-7-22(8-10-23)31-25-24(28-2)16-20-11-14-35(27(20)32-25)18-21-6-5-12-30-26(21)33(3)38(4,36)37/h5-12,14,16,19,29H,13,15,17-18H2,1,3-4H3,(H,31,32)/t19-/m0/s1 |
| InChIKey | NDSGAVVJRXXTAI-IBGZPJMESA-N |
| XLogP | 3.97 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|