C27H33N7O2S — CID 122438961
N-methyl-N-[2-[1-[2-[4-(3-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]phenyl]methanesulfonamide (PubChem CID 122438961) has the molecular formula C27H33N7O2S and a molecular weight of 519.68 g/mol. Its IUPAC name is N-methyl-N-[2-[1-[2-[4-(3-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-[1-[2-[4-(3-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 122438961 |
| Molecular Formula | C27H33N7O2S |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-methyl-N-[2-[1-[2-[4-(3-methylpiperazin-1-yl)anilino]pyrrolo[2,3-d]pyrimidin-7-yl]ethyl]phenyl]methanesulfonamide |
| SMILES | CC1CN(c2ccc(Nc3ncc4ccn(C(C)c5ccccc5N(C)S(C)(=O)=O)c4n3)cc2)CCN1 |
| InChI | InChI=1S/C27H33N7O2S/c1-19-18-33(16-14-28-19)23-11-9-22(10-12-23)30-27-29-17-21-13-15-34(26(21)31-27)20(2)24-7-5-6-8-25(24)32(3)37(4,35)36/h5-13,15,17,19-20,28H,14,16,18H2,1-4H3,(H,29,30,31) |
| InChIKey | AGZXAWYIXSQQOQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|