C27H32FN7O2S — CID 144806832
3-fluoro-N-methyl-N-[2-[[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]propane-1-sulfonamide (PubChem CID 144806832) has the molecular formula C27H32FN7O2S and a molecular weight of 537.67 g/mol. Its IUPAC name is 3-fluoro-N-methyl-N-[2-[[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]propane-1-sulfonamide.
| Compound Name | 3-fluoro-N-methyl-N-[2-[[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 144806832 |
| Molecular Formula | C27H32FN7O2S |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 3-fluoro-N-methyl-N-[2-[[2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]propane-1-sulfonamide |
| SMILES | CN(c1ccccc1Cn1ccc2cnc(Nc3ccc(N4CCNCC4)cc3)nc21)S(=O)(=O)CCCF |
| InChI | InChI=1S/C27H32FN7O2S/c1-33(38(36,37)18-4-12-28)25-6-3-2-5-22(25)20-35-15-11-21-19-30-27(32-26(21)35)31-23-7-9-24(10-8-23)34-16-13-29-14-17-34/h2-3,5-11,15,19,29H,4,12-14,16-18,20H2,1H3,(H,30,31,32) |
| InChIKey | GGEUFIHUPPSQKT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|