C25H28FN7 — CID 123341981
7-[[5-fluoro-2-(methylamino)phenyl]methyl]-N-[4-(3-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 123341981) has the molecular formula C25H28FN7 and a molecular weight of 445.55 g/mol. Its IUPAC name is 7-[[5-fluoro-2-(methylamino)phenyl]methyl]-N-[4-(3-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[[5-fluoro-2-(methylamino)phenyl]methyl]-N-[4-(3-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123341981 |
| Molecular Formula | C25H28FN7 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 7-[[5-fluoro-2-(methylamino)phenyl]methyl]-N-[4-(3-methylpiperazin-1-yl)phenyl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1ccc(F)cc1Cn1ccc2cnc(Nc3ccc(N4CCNC(C)C4)cc3)nc21 |
| InChI | InChI=1S/C25H28FN7/c1-17-15-32(12-10-28-17)22-6-4-21(5-7-22)30-25-29-14-18-9-11-33(24(18)31-25)16-19-13-20(26)3-8-23(19)27-2/h3-9,11,13-14,17,27-28H,10,12,15-16H2,1-2H3,(H,29,30,31) |
| InChIKey | VAXRCXNCOYAHTO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|