C20H23N3O3 — CID 140739534
(E)-3-[2-[hydroxy-[(3-morpholin-4-ylphenyl)methyl]amino]phenyl]prop-2-enamide (PubChem CID 140739534) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (E)-3-[2-[hydroxy-[(3-morpholin-4-ylphenyl)methyl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[hydroxy-[(3-morpholin-4-ylphenyl)methyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140739534 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (E)-3-[2-[hydroxy-[(3-morpholin-4-ylphenyl)methyl]amino]phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccccc1N(O)Cc1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H23N3O3/c21-20(24)9-8-17-5-1-2-7-19(17)23(25)15-16-4-3-6-18(14-16)22-10-12-26-13-11-22/h1-9,14,25H,10-13,15H2,(H2,21,24)/b9-8+ |
| InChIKey | WPPXVEHKSFWEIQ-CMDGGOBGSA-N |
| XLogP | 2.42 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|