C10H19NO3S — CID 140741576
[(2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] sulfamate (PubChem CID 140741576) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is [(2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] sulfamate.
| Compound Name | [(2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] sulfamate |
|---|---|
| PubChem CID | 140741576 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [(2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] sulfamate |
| SMILES | CC1(C)[C@H]2CCC1(C)[C@H](OS(N)(=O)=O)C2 |
| InChI | InChI=1S/C10H19NO3S/c1-9(2)7-4-5-10(9,3)8(6-7)14-15(11,12)13/h7-8H,4-6H2,1-3H3,(H2,11,12,13)/t7-,8+,10?/m0/s1 |
| InChIKey | OITCWXSXONLGLW-VLCSVPMDSA-N |
| XLogP | 1.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |