C21H32NO3S2+ — CID 140741705
1-(4-cyclohexylphenyl)-2-methyl-2-(4-methylsulfonylthiomorpholin-1-ium-1-yl)propan-1-one (PubChem CID 140741705) has the molecular formula C21H32NO3S2+ and a molecular weight of 410.63 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-2-methyl-2-(4-methylsulfonylthiomorpholin-1-ium-1-yl)propan-1-one.
| Compound Name | 1-(4-cyclohexylphenyl)-2-methyl-2-(4-methylsulfonylthiomorpholin-1-ium-1-yl)propan-1-one |
|---|---|
| PubChem CID | 140741705 |
| Molecular Formula | C21H32NO3S2+ |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-2-methyl-2-(4-methylsulfonylthiomorpholin-1-ium-1-yl)propan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(C2CCCCC2)cc1)[S+]1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C21H32NO3S2/c1-21(2,26-15-13-22(14-16-26)27(3,24)25)20(23)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h9-12,17H,4-8,13-16H2,1-3H3/q+1 |
| InChIKey | KAZRMXXVZUILAQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|