C28H46F4NO2S2+ — CID 144560326
butane;1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfinyl)thiomorpholin-1-ium-1-yl]butan-1-one;fluoromethane (PubChem CID 144560326) has the molecular formula C28H46F4NO2S2+ and a molecular weight of 568.81 g/mol. Its IUPAC name is butane;1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfinyl)thiomorpholin-1-ium-1-yl]butan-1-one;fluoromethane.
| Compound Name | butane;1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfinyl)thiomorpholin-1-ium-1-yl]butan-1-one;fluoromethane |
|---|---|
| PubChem CID | 144560326 |
| Molecular Formula | C28H46F4NO2S2+ |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | butane;1-(4-cyclohexylphenyl)-3,3-dimethyl-2-[4-(trifluoromethylsulfinyl)thiomorpholin-1-ium-1-yl]butan-1-one;fluoromethane |
| SMILES | CC(C)(C)C(C(=O)c1ccc(C2CCCCC2)cc1)[S+]1CCN(S(=O)C(F)(F)F)CC1.CCCC.CF |
| InChI | InChI=1S/C23H33F3NO2S2.C4H10.CH3F/c1-22(2,3)21(30-15-13-27(14-16-30)31(29)23(24,25)26)20(28)19-11-9-18(10-12-19)17-7-5-4-6-8-17;1-3-4-2;1-2/h9-12,17,21H,4-8,13-16H2,1-3H3;3-4H2,1-2H3;1H3/q+1;; |
| InChIKey | XGQZQRAXGTUTKC-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|