C23H34NO3S+ — CID 140741709
methyl 1-[1-cyclohexyl-2-oxo-2-(4-propan-2-ylphenyl)ethyl]thiomorpholin-1-ium-4-carboxylate (PubChem CID 140741709) has the molecular formula C23H34NO3S+ and a molecular weight of 404.60 g/mol. Its IUPAC name is methyl 1-[1-cyclohexyl-2-oxo-2-(4-propan-2-ylphenyl)ethyl]thiomorpholin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[1-cyclohexyl-2-oxo-2-(4-propan-2-ylphenyl)ethyl]thiomorpholin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 140741709 |
| Molecular Formula | C23H34NO3S+ |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | methyl 1-[1-cyclohexyl-2-oxo-2-(4-propan-2-ylphenyl)ethyl]thiomorpholin-1-ium-4-carboxylate |
| SMILES | COC(=O)N1CC[S+](C(C(=O)c2ccc(C(C)C)cc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34NO3S/c1-17(2)18-9-11-19(12-10-18)21(25)22(20-7-5-4-6-8-20)28-15-13-24(14-16-28)23(26)27-3/h9-12,17,20,22H,4-8,13-16H2,1-3H3/q+1 |
| InChIKey | DMYFDMUYVQPNJO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|