C19H28NO3S+ — CID 140741715
methyl 1-[1-oxo-1-(4-propan-2-ylphenyl)butan-2-yl]thiomorpholin-1-ium-4-carboxylate (PubChem CID 140741715) has the molecular formula C19H28NO3S+ and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl 1-[1-oxo-1-(4-propan-2-ylphenyl)butan-2-yl]thiomorpholin-1-ium-4-carboxylate.
| Compound Name | methyl 1-[1-oxo-1-(4-propan-2-ylphenyl)butan-2-yl]thiomorpholin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 140741715 |
| Molecular Formula | C19H28NO3S+ |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 1-[1-oxo-1-(4-propan-2-ylphenyl)butan-2-yl]thiomorpholin-1-ium-4-carboxylate |
| SMILES | CCC(C(=O)c1ccc(C(C)C)cc1)[S+]1CCN(C(=O)OC)CC1 |
| InChI | InChI=1S/C19H28NO3S/c1-5-17(24-12-10-20(11-13-24)19(22)23-4)18(21)16-8-6-15(7-9-16)14(2)3/h6-9,14,17H,5,10-13H2,1-4H3/q+1 |
| InChIKey | NOPPPZSVLRGQHZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|