C31H27NO4 — CID 140746559
(3R,4S)-2-oxo-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxylic acid (PubChem CID 140746559) has the molecular formula C31H27NO4 and a molecular weight of 477.56 g/mol. Its IUPAC name is (3R,4S)-2-oxo-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxylic acid.
| Compound Name | (3R,4S)-2-oxo-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 140746559 |
| Molecular Formula | C31H27NO4 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (3R,4S)-2-oxo-4-(phenylmethoxymethyl)-1-tritylazetidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C31H27NO4/c33-29-28(30(34)35)27(22-36-21-23-13-5-1-6-14-23)32(29)31(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-28H,21-22H2,(H,34,35)/t27-,28-/m1/s1 |
| InChIKey | XNBGDZAKKYUMPH-VSGBNLITSA-N |
| XLogP | 5.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|