C21H19N3O4S3 — CID 140751554
2-methyl-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 140751554) has the molecular formula C21H19N3O4S3 and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-methyl-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-methyl-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 140751554 |
| Molecular Formula | C21H19N3O4S3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 2-methyl-4-[2-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1cc(-c2cncc3cc(C=C4SC(=S)NC4=O)oc23)ccc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C21H19N3O4S3/c1-11(2)24-31(26,27)18-5-4-13(6-12(18)3)16-10-22-9-14-7-15(28-19(14)16)8-17-20(25)23-21(29)30-17/h4-11,24H,1-3H3,(H,23,25,29) |
| InChIKey | ZLEURXGCIXWONL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|