C25H31ClF3N3OSSi — CID 140752387
N-(3-chloro-4-fluorophenyl)-6,7-difluoro-2-[2-tri(propan-2-yl)silyloxyethyl]-3H-benzimidazole-4-carbothioamide (PubChem CID 140752387) has the molecular formula C25H31ClF3N3OSSi and a molecular weight of 542.14 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6,7-difluoro-2-[2-tri(propan-2-yl)silyloxyethyl]-3H-benzimidazole-4-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6,7-difluoro-2-[2-tri(propan-2-yl)silyloxyethyl]-3H-benzimidazole-4-carbothioamide |
|---|---|
| PubChem CID | 140752387 |
| Molecular Formula | C25H31ClF3N3OSSi |
| Molecular Weight | 542.14 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6,7-difluoro-2-[2-tri(propan-2-yl)silyloxyethyl]-3H-benzimidazole-4-carbothioamide |
| SMILES | CC(C)[Si](OCCc1nc2c(F)c(F)cc(C(=S)Nc3ccc(F)c(Cl)c3)c2[nH]1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H31ClF3N3OSSi/c1-13(2)35(14(3)4,15(5)6)33-10-9-21-31-23-17(12-20(28)22(29)24(23)32-21)25(34)30-16-7-8-19(27)18(26)11-16/h7-8,11-15H,9-10H2,1-6H3,(H,30,34)(H,31,32) |
| InChIKey | PBVFJECLTJDWLQ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.14 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|