C21H21ClF3N5O3 — CID 122696149
tert-butyl N-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamate (PubChem CID 122696149) has the molecular formula C21H21ClF3N5O3 and a molecular weight of 483.88 g/mol. Its IUPAC name is tert-butyl N-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 122696149 |
| Molecular Formula | C21H21ClF3N5O3 |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | tert-butyl N-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc2c(F)c(F)cc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C21H21ClF3N5O3/c1-21(2,3)33-20(31)26-7-6-15-28-17-11(9-14(24)16(25)18(17)29-15)19(30-32)27-10-4-5-13(23)12(22)8-10/h4-5,8-9,32H,6-7H2,1-3H3,(H,26,31)(H,27,30)(H,28,29) |
| InChIKey | BFSRVENTMGUTEF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|