C19H15ClF3N7O — CID 122686905
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[(2-methylpyrazol-3-yl)methylamino]-3H-benzimidazole-4-carboximidamide (PubChem CID 122686905) has the molecular formula C19H15ClF3N7O and a molecular weight of 449.82 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[(2-methylpyrazol-3-yl)methylamino]-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[(2-methylpyrazol-3-yl)methylamino]-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122686905 |
| Molecular Formula | C19H15ClF3N7O |
| Molecular Weight | 449.82 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[(2-methylpyrazol-3-yl)methylamino]-3H-benzimidazole-4-carboximidamide |
| SMILES | Cn1nccc1CNc1nc2c(F)c(F)cc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C19H15ClF3N7O/c1-30-10(4-5-25-30)8-24-19-27-16-11(7-14(22)15(23)17(16)28-19)18(29-31)26-9-2-3-13(21)12(20)6-9/h2-7,31H,8H2,1H3,(H,26,29)(H2,24,27,28) |
| InChIKey | HRIPLDRUOJUQJW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|