C20H20ClF3N6O3S — CID 122687715
N'-(3-chloro-4-fluorophenyl)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122687715) has the molecular formula C20H20ClF3N6O3S and a molecular weight of 516.93 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122687715 |
| Molecular Formula | C20H20ClF3N6O3S |
| Molecular Weight | 516.93 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | O=S1(=O)CCN(CCNc2nc3c(F)c(F)cc(/C(=N/c4ccc(F)c(Cl)c4)NO)c3[nH]2)CC1 |
| InChI | InChI=1S/C20H20ClF3N6O3S/c21-13-9-11(1-2-14(13)22)26-19(29-31)12-10-15(23)16(24)18-17(12)27-20(28-18)25-3-4-30-5-7-34(32,33)8-6-30/h1-2,9-10,31H,3-8H2,(H,26,29)(H2,25,27,28) |
| InChIKey | XKGYPYRLRYAJEW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.93 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|