C17H15ClF3N5O3S — CID 122686919
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(2-methylsulfonylethylamino)-3H-benzimidazole-4-carboximidamide (PubChem CID 122686919) has the molecular formula C17H15ClF3N5O3S and a molecular weight of 461.85 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(2-methylsulfonylethylamino)-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(2-methylsulfonylethylamino)-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122686919 |
| Molecular Formula | C17H15ClF3N5O3S |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(2-methylsulfonylethylamino)-3H-benzimidazole-4-carboximidamide |
| SMILES | CS(=O)(=O)CCNc1nc2c(F)c(F)cc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C17H15ClF3N5O3S/c1-30(28,29)5-4-22-17-24-14-9(7-12(20)13(21)15(14)25-17)16(26-27)23-8-2-3-11(19)10(18)6-8/h2-3,6-7,27H,4-5H2,1H3,(H,23,26)(H2,22,24,25) |
| InChIKey | CNGVVSVNOSMQGX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|